C34H26O4 — CID 87393935
(2-benzoyloxy-6-ethyl-3,4-diphenylphenyl) benzoate (PubChem CID 87393935) has the molecular formula C34H26O4 and a molecular weight of 498.58 g/mol. Its IUPAC name is (2-benzoyloxy-6-ethyl-3,4-diphenylphenyl) benzoate.
| Compound Name | (2-benzoyloxy-6-ethyl-3,4-diphenylphenyl) benzoate |
|---|---|
| PubChem CID | 87393935 |
| Molecular Formula | C34H26O4 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | (2-benzoyloxy-6-ethyl-3,4-diphenylphenyl) benzoate |
| SMILES | CCc1cc(-c2ccccc2)c(-c2ccccc2)c(OC(=O)c2ccccc2)c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H26O4/c1-2-24-23-29(25-15-7-3-8-16-25)30(26-17-9-4-10-18-26)32(38-34(36)28-21-13-6-14-22-28)31(24)37-33(35)27-19-11-5-12-20-27/h3-23H,2H2,1H3 |
| InChIKey | LSNXIPRDYXKFFJ-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|