C27H28O4 — CID 87397213
(2-benzoyloxy-4,6-diethyl-3-propan-2-ylphenyl) benzoate (PubChem CID 87397213) has the molecular formula C27H28O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is (2-benzoyloxy-4,6-diethyl-3-propan-2-ylphenyl) benzoate.
| Compound Name | (2-benzoyloxy-4,6-diethyl-3-propan-2-ylphenyl) benzoate |
|---|---|
| PubChem CID | 87397213 |
| Molecular Formula | C27H28O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | (2-benzoyloxy-4,6-diethyl-3-propan-2-ylphenyl) benzoate |
| SMILES | CCc1cc(CC)c(C(C)C)c(OC(=O)c2ccccc2)c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H28O4/c1-5-19-17-20(6-2)24(30-26(28)21-13-9-7-10-14-21)25(23(19)18(3)4)31-27(29)22-15-11-8-12-16-22/h7-18H,5-6H2,1-4H3 |
| InChIKey | RVOLOAIJCIWMGT-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|