C12H17FN4O2 — CID 3479212
3-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1,3-oxazinane (PubChem CID 3479212) has the molecular formula C12H17FN4O2 and a molecular weight of 268.29 g/mol. Its IUPAC name is 3-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1,3-oxazinane.
| Compound Name | 3-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1,3-oxazinane |
|---|---|
| PubChem CID | 3479212 |
| Molecular Formula | C12H17FN4O2 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 3-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1,3-oxazinane |
| SMILES | Fc1cnc(N2CCCOC2)nc1N1CCOCC1 |
| InChI | InChI=1S/C12H17FN4O2/c13-10-8-14-12(17-2-1-5-19-9-17)15-11(10)16-3-6-18-7-4-16/h8H,1-7,9H2 |
| InChIKey | CTEHRHOJHPTZAR-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |