C17H17N5O — CID 3479964
3-[(2,6-dipyridin-3-ylpyrimidin-4-yl)amino]propan-1-ol (PubChem CID 3479964) has the molecular formula C17H17N5O and a molecular weight of 307.36 g/mol. Its IUPAC name is 3-[(2,6-dipyridin-3-ylpyrimidin-4-yl)amino]propan-1-ol.
| Compound Name | 3-[(2,6-dipyridin-3-ylpyrimidin-4-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 3479964 |
| Molecular Formula | C17H17N5O |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 3-[(2,6-dipyridin-3-ylpyrimidin-4-yl)amino]propan-1-ol |
| SMILES | OCCCNc1cc(-c2cccnc2)nc(-c2cccnc2)n1 |
| InChI | InChI=1S/C17H17N5O/c23-9-3-8-20-16-10-15(13-4-1-6-18-11-13)21-17(22-16)14-5-2-7-19-12-14/h1-2,4-7,10-12,23H,3,8-9H2,(H,20,21,22) |
| InChIKey | NHJWEEYLYXBCHK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|