About 2-(2-phenyl-1,3-oxazol-4-yl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide
2-(2-phenyl-1,3-oxazol-4-yl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide (PubChem CID 34810970) has the molecular formula C20H17F3N2O2
and a molecular weight of 374.36 g/mol. Its IUPAC name is 2-(2-phenyl-1,3-oxazol-4-yl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide.
Molecular Properties
| Compound Name | 2-(2-phenyl-1,3-oxazol-4-yl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide |
| PubChem CID | 34810970 |
| Molecular Formula | C20H17F3N2O2 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 2-(2-phenyl-1,3-oxazol-4-yl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide |
| SMILES | O=C(Cc1coc(-c2ccccc2)n1)NCCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H17F3N2O2/c21-20(22,23)16-8-6-14(7-9-16)10-11-24-18(26)12-17-13-27-19(25-17)15-4-2-1-3-5-15/h1-9,13H,10-12H2,(H,24,26) |
| InChIKey | NKHJRFYWWWSQHJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-phenyl-1,3-oxazol-4-yl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-phenyl-1,3-oxazol-4-yl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide?
The IUPAC name of 2-(2-phenyl-1,3-oxazol-4-yl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide (CID 34810970) is 2-(2-phenyl-1,3-oxazol-4-yl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide.
What is the SMILES notation for 2-(2-phenyl-1,3-oxazol-4-yl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide?
The canonical SMILES for 2-(2-phenyl-1,3-oxazol-4-yl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide is O=C(Cc1coc(-c2ccccc2)n1)NCCc1ccc(C(F)(F)F)cc1.
What is the InChIKey of 2-(2-phenyl-1,3-oxazol-4-yl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide?
The InChIKey is NKHJRFYWWWSQHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17F3N2O2/c21-20(22,23)16-8-6-14(7-9-16)10-11-24-18(26)12-17-13-27-19(25-17)15-4-2-1-3-5-15/h1-9,13H,10-12H2,(H,24,26).
What are the key properties of 2-(2-phenyl-1,3-oxazol-4-yl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide?
2-(2-phenyl-1,3-oxazol-4-yl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide has a molecular weight of 374.36 g/mol, XLogP of 4.26, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-phenyl-1,3-oxazol-4-yl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide is sourced from PubChem (CID 34810970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).