C24H25NO — CID 3481310
1-(4-methylphenyl)-3-(2-pyrrolidin-1-yl-3,4-dihydronaphthalen-1-yl)prop-2-en-1-one (PubChem CID 3481310) has the molecular formula C24H25NO and a molecular weight of 343.47 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-(2-pyrrolidin-1-yl-3,4-dihydronaphthalen-1-yl)prop-2-en-1-one.
| Compound Name | 1-(4-methylphenyl)-3-(2-pyrrolidin-1-yl-3,4-dihydronaphthalen-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3481310 |
| Molecular Formula | C24H25NO |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 1-(4-methylphenyl)-3-(2-pyrrolidin-1-yl-3,4-dihydronaphthalen-1-yl)prop-2-en-1-one |
| SMILES | Cc1ccc(C(=O)C=CC2=C(N3CCCC3)CCc3ccccc32)cc1 |
| InChI | InChI=1S/C24H25NO/c1-18-8-10-20(11-9-18)24(26)15-13-22-21-7-3-2-6-19(21)12-14-23(22)25-16-4-5-17-25/h2-3,6-11,13,15H,4-5,12,14,16-17H2,1H3 |
| InChIKey | YNXGGXBRLFSPFI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|