C28H23N3O6S — CID 3481718
propan-2-yl 7-methyl-2-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 3481718) has the molecular formula C28H23N3O6S and a molecular weight of 529.57 g/mol. Its IUPAC name is propan-2-yl 7-methyl-2-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | propan-2-yl 7-methyl-2-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 3481718 |
| Molecular Formula | C28H23N3O6S |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | propan-2-yl 7-methyl-2-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)C)C(c2ccccc2)n2c(sc(=Cc3ccc(-c4ccccc4[N+](=O)[O-])o3)c2=O)=N1 |
| InChI | InChI=1S/C28H23N3O6S/c1-16(2)36-27(33)24-17(3)29-28-30(25(24)18-9-5-4-6-10-18)26(32)23(38-28)15-19-13-14-22(37-19)20-11-7-8-12-21(20)31(34)35/h4-16,25H,1-3H3 |
| InChIKey | WWIWIJNTYFFOMU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 116.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|