C31H29N3O7S — CID 3981880
2-methoxyethyl 7-methyl-2-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5-(4-propan-2-ylphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 3981880) has the molecular formula C31H29N3O7S and a molecular weight of 587.65 g/mol. Its IUPAC name is 2-methoxyethyl 7-methyl-2-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5-(4-propan-2-ylphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | 2-methoxyethyl 7-methyl-2-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5-(4-propan-2-ylphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 3981880 |
| Molecular Formula | C31H29N3O7S |
| Molecular Weight | 587.65 g/mol |
| Exact Mass | 587.17 |
| IUPAC Name | 2-methoxyethyl 7-methyl-2-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5-(4-propan-2-ylphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | COCCOC(=O)C1=C(C)N=c2sc(=Cc3ccc(-c4ccccc4[N+](=O)[O-])o3)c(=O)n2C1c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C31H29N3O7S/c1-18(2)20-9-11-21(12-10-20)28-27(30(36)40-16-15-39-4)19(3)32-31-33(28)29(35)26(42-31)17-22-13-14-25(41-22)23-7-5-6-8-24(23)34(37)38/h5-14,17-18,28H,15-16H2,1-4H3 |
| InChIKey | BHADOBKMFQDQEE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 126.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.65 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|