C21H23NO5 — CID 3483838
dimethyl 1-[1-(benzylamino)but-3-enyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 3483838) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is dimethyl 1-[1-(benzylamino)but-3-enyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[1-(benzylamino)but-3-enyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 3483838 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | dimethyl 1-[1-(benzylamino)but-3-enyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | C=CCC(NCc1ccccc1)C12C=CC(O1)C(C(=O)OC)=C2C(=O)OC |
| InChI | InChI=1S/C21H23NO5/c1-4-8-16(22-13-14-9-6-5-7-10-14)21-12-11-15(27-21)17(19(23)25-2)18(21)20(24)26-3/h4-7,9-12,15-16,22H,1,8,13H2,2-3H3 |
| InChIKey | NNLFWGOMDHRMET-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|