C22H20ClFN2O3 — CID 34845026
3-(2-chloro-6-fluorophenyl)-N,5-dimethyl-N-[(4-prop-2-enoxyphenyl)methyl]-1,2-oxazole-4-carboxamide (PubChem CID 34845026) has the molecular formula C22H20ClFN2O3 and a molecular weight of 414.86 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-N,5-dimethyl-N-[(4-prop-2-enoxyphenyl)methyl]-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(2-chloro-6-fluorophenyl)-N,5-dimethyl-N-[(4-prop-2-enoxyphenyl)methyl]-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 34845026 |
| Molecular Formula | C22H20ClFN2O3 |
| Molecular Weight | 414.86 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-N,5-dimethyl-N-[(4-prop-2-enoxyphenyl)methyl]-1,2-oxazole-4-carboxamide |
| SMILES | C=CCOc1ccc(CN(C)C(=O)c2c(-c3c(F)cccc3Cl)noc2C)cc1 |
| InChI | InChI=1S/C22H20ClFN2O3/c1-4-12-28-16-10-8-15(9-11-16)13-26(3)22(27)19-14(2)29-25-21(19)20-17(23)6-5-7-18(20)24/h4-11H,1,12-13H2,2-3H3 |
| InChIKey | FYYBSKPPTLKWKF-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.86 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|