C18H21FN2O2S — CID 3485228
2-[3-[2-(4-fluorophenyl)-1,3-dioxolan-2-yl]propylsulfanyl]-4,6-dimethylpyrimidine (PubChem CID 3485228) has the molecular formula C18H21FN2O2S and a molecular weight of 348.44 g/mol. Its IUPAC name is 2-[3-[2-(4-fluorophenyl)-1,3-dioxolan-2-yl]propylsulfanyl]-4,6-dimethylpyrimidine.
| Compound Name | 2-[3-[2-(4-fluorophenyl)-1,3-dioxolan-2-yl]propylsulfanyl]-4,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 3485228 |
| Molecular Formula | C18H21FN2O2S |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 2-[3-[2-(4-fluorophenyl)-1,3-dioxolan-2-yl]propylsulfanyl]-4,6-dimethylpyrimidine |
| SMILES | Cc1cc(C)nc(SCCCC2(c3ccc(F)cc3)OCCO2)n1 |
| InChI | InChI=1S/C18H21FN2O2S/c1-13-12-14(2)21-17(20-13)24-11-3-8-18(22-9-10-23-18)15-4-6-16(19)7-5-15/h4-7,12H,3,8-11H2,1-2H3 |
| InChIKey | BBROKGOIKQJOHT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|