C19H17Cl2FN2O2 — CID 34855876
4-chloro-N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 34855876) has the molecular formula C19H17Cl2FN2O2 and a molecular weight of 395.26 g/mol. Its IUPAC name is 4-chloro-N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | 4-chloro-N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 34855876 |
| Molecular Formula | C19H17Cl2FN2O2 |
| Molecular Weight | 395.26 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 4-chloro-N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | CN(Cc1c(F)cccc1Cl)C(=O)c1ccc(Cl)cc1N1CCCC1=O |
| InChI | InChI=1S/C19H17Cl2FN2O2/c1-23(11-14-15(21)4-2-5-16(14)22)19(26)13-8-7-12(20)10-17(13)24-9-3-6-18(24)25/h2,4-5,7-8,10H,3,6,9,11H2,1H3 |
| InChIKey | NXKUGFSRILFDOU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.26 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |