C21H24ClN3O2 — CID 36670953
4-chloro-N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-2-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 36670953) has the molecular formula C21H24ClN3O2 and a molecular weight of 385.90 g/mol. Its IUPAC name is 4-chloro-N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-2-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | 4-chloro-N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-2-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 36670953 |
| Molecular Formula | C21H24ClN3O2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 4-chloro-N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-2-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | CN(Cc1ccc(N(C)C)cc1)C(=O)c1ccc(Cl)cc1N1CCCC1=O |
| InChI | InChI=1S/C21H24ClN3O2/c1-23(2)17-9-6-15(7-10-17)14-24(3)21(27)18-11-8-16(22)13-19(18)25-12-4-5-20(25)26/h6-11,13H,4-5,12,14H2,1-3H3 |
| InChIKey | AYACNVSLALXQFB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|