C18H18ClN3O4S — CID 42889160
4-chloro-2-(2-oxopyrrolidin-1-yl)-N-[(4-sulfamoylphenyl)methyl]benzamide (PubChem CID 42889160) has the molecular formula C18H18ClN3O4S and a molecular weight of 407.88 g/mol. Its IUPAC name is 4-chloro-2-(2-oxopyrrolidin-1-yl)-N-[(4-sulfamoylphenyl)methyl]benzamide.
| Compound Name | 4-chloro-2-(2-oxopyrrolidin-1-yl)-N-[(4-sulfamoylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 42889160 |
| Molecular Formula | C18H18ClN3O4S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 4-chloro-2-(2-oxopyrrolidin-1-yl)-N-[(4-sulfamoylphenyl)methyl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)c2ccc(Cl)cc2N2CCCC2=O)cc1 |
| InChI | InChI=1S/C18H18ClN3O4S/c19-13-5-8-15(16(10-13)22-9-1-2-17(22)23)18(24)21-11-12-3-6-14(7-4-12)27(20,25)26/h3-8,10H,1-2,9,11H2,(H,21,24)(H2,20,25,26) |
| InChIKey | WQGVBAKHZVQOGF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |