C20H19BrN2O6 — CID 34860647
[2-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl] 4-bromo-3-nitrobenzoate (PubChem CID 34860647) has the molecular formula C20H19BrN2O6 and a molecular weight of 463.28 g/mol. Its IUPAC name is [2-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl] 4-bromo-3-nitrobenzoate.
| Compound Name | [2-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl] 4-bromo-3-nitrobenzoate |
|---|---|
| PubChem CID | 34860647 |
| Molecular Formula | C20H19BrN2O6 |
| Molecular Weight | 463.28 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | [2-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl] 4-bromo-3-nitrobenzoate |
| SMILES | COc1ccc(CN(C(=O)COC(=O)c2ccc(Br)c([N+](=O)[O-])c2)C2CC2)cc1 |
| InChI | InChI=1S/C20H19BrN2O6/c1-28-16-7-2-13(3-8-16)11-22(15-5-6-15)19(24)12-29-20(25)14-4-9-17(21)18(10-14)23(26)27/h2-4,7-10,15H,5-6,11-12H2,1H3 |
| InChIKey | LTWVNJFVSLTIFF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.28 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|