C22H21ClN2O6 — CID 34712564
[2-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl] (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate (PubChem CID 34712564) has the molecular formula C22H21ClN2O6 and a molecular weight of 444.87 g/mol. Its IUPAC name is [2-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl] (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate.
| Compound Name | [2-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl] (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 34712564 |
| Molecular Formula | C22H21ClN2O6 |
| Molecular Weight | 444.87 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | [2-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl] (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate |
| SMILES | COc1ccc(CN(C(=O)COC(=O)/C=C/c2ccc(Cl)c([N+](=O)[O-])c2)C2CC2)cc1 |
| InChI | InChI=1S/C22H21ClN2O6/c1-30-18-8-2-16(3-9-18)13-24(17-6-7-17)21(26)14-31-22(27)11-5-15-4-10-19(23)20(12-15)25(28)29/h2-5,8-12,17H,6-7,13-14H2,1H3/b11-5+ |
| InChIKey | NSSLQMHNMQQACT-VZUCSPMQSA-N |
| XLogP | 4.00 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.87 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|