C17H12Cl3N3O5 — CID 41356244
[2-[(3,5-dichloro-6-methyl-2-pyridinyl)amino]-2-oxoethyl] (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate (PubChem CID 41356244) has the molecular formula C17H12Cl3N3O5 and a molecular weight of 444.66 g/mol. Its IUPAC name is [2-[(3,5-dichloro-6-methyl-2-pyridinyl)amino]-2-oxoethyl] (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate.
| Compound Name | [2-[(3,5-dichloro-6-methyl-2-pyridinyl)amino]-2-oxoethyl] (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 41356244 |
| Molecular Formula | C17H12Cl3N3O5 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 442.98 |
| IUPAC Name | [2-[(3,5-dichloro-6-methyl-2-pyridinyl)amino]-2-oxoethyl] (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate |
| SMILES | Cc1nc(NC(=O)COC(=O)/C=C/c2ccc(Cl)c([N+](=O)[O-])c2)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H12Cl3N3O5/c1-9-12(19)7-13(20)17(21-9)22-15(24)8-28-16(25)5-3-10-2-4-11(18)14(6-10)23(26)27/h2-7H,8H2,1H3,(H,21,22,24)/b5-3+ |
| InChIKey | FTGRCFIKWQCCRM-HWKANZROSA-N |
| XLogP | 4.45 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|