C15H16ClN3O6 — CID 71954253
[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 3-(4-chloro-3-nitrophenyl)prop-2-enoate (PubChem CID 71954253) has the molecular formula C15H16ClN3O6 and a molecular weight of 369.76 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 3-(4-chloro-3-nitrophenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 3-(4-chloro-3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 71954253 |
| Molecular Formula | C15H16ClN3O6 |
| Molecular Weight | 369.76 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 3-(4-chloro-3-nitrophenyl)prop-2-enoate |
| SMILES | CC(C)NC(=O)NC(=O)COC(=O)C=Cc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H16ClN3O6/c1-9(2)17-15(22)18-13(20)8-25-14(21)6-4-10-3-5-11(16)12(7-10)19(23)24/h3-7,9H,8H2,1-2H3,(H2,17,18,20,22) |
| InChIKey | HYPBBBZBPMYXCE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.76 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|