C19H16Cl2N2O6 — CID 41357847
[2-(4-chloro-2-methoxy-5-methylanilino)-2-oxoethyl] (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate (PubChem CID 41357847) has the molecular formula C19H16Cl2N2O6 and a molecular weight of 439.25 g/mol. Its IUPAC name is [2-(4-chloro-2-methoxy-5-methylanilino)-2-oxoethyl] (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate.
| Compound Name | [2-(4-chloro-2-methoxy-5-methylanilino)-2-oxoethyl] (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 41357847 |
| Molecular Formula | C19H16Cl2N2O6 |
| Molecular Weight | 439.25 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | [2-(4-chloro-2-methoxy-5-methylanilino)-2-oxoethyl] (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)COC(=O)/C=C/c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H16Cl2N2O6/c1-11-7-15(17(28-2)9-14(11)21)22-18(24)10-29-19(25)6-4-12-3-5-13(20)16(8-12)23(26)27/h3-9H,10H2,1-2H3,(H,22,24)/b6-4+ |
| InChIKey | LSESXHHSNZWEGY-GQCTYLIASA-N |
| XLogP | 4.41 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.25 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|