C22H24N4O4S2 — CID 34868039
N-ethyl-2-[3-[[2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]acetyl]amino]phenoxy]acetamide (PubChem CID 34868039) has the molecular formula C22H24N4O4S2 and a molecular weight of 472.59 g/mol. Its IUPAC name is N-ethyl-2-[3-[[2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]acetyl]amino]phenoxy]acetamide.
| Compound Name | N-ethyl-2-[3-[[2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]acetyl]amino]phenoxy]acetamide |
|---|---|
| PubChem CID | 34868039 |
| Molecular Formula | C22H24N4O4S2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | N-ethyl-2-[3-[[2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]acetyl]amino]phenoxy]acetamide |
| SMILES | CCNC(=O)COc1cccc(NC(=O)CSCc2nc3sc4c(c3c(=O)[nH]2)CCC4)c1 |
| InChI | InChI=1S/C22H24N4O4S2/c1-2-23-18(27)10-30-14-6-3-5-13(9-14)24-19(28)12-31-11-17-25-21(29)20-15-7-4-8-16(15)32-22(20)26-17/h3,5-6,9H,2,4,7-8,10-12H2,1H3,(H,23,27)(H,24,28)(H,25,26,29) |
| InChIKey | KMJKEJGTCNUGME-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |