C25H22N4O4 — CID 34881735
N-[(5S)-5-[2-(benzylamino)-2-oxoethyl]-2,4-dioxo-3-phenylimidazolidin-1-yl]benzamide (PubChem CID 34881735) has the molecular formula C25H22N4O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is N-[(5S)-5-[2-(benzylamino)-2-oxoethyl]-2,4-dioxo-3-phenylimidazolidin-1-yl]benzamide.
| Compound Name | N-[(5S)-5-[2-(benzylamino)-2-oxoethyl]-2,4-dioxo-3-phenylimidazolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 34881735 |
| Molecular Formula | C25H22N4O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | N-[(5S)-5-[2-(benzylamino)-2-oxoethyl]-2,4-dioxo-3-phenylimidazolidin-1-yl]benzamide |
| SMILES | O=C(C[C@H]1C(=O)N(c2ccccc2)C(=O)N1NC(=O)c1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C25H22N4O4/c30-22(26-17-18-10-4-1-5-11-18)16-21-24(32)28(20-14-8-3-9-15-20)25(33)29(21)27-23(31)19-12-6-2-7-13-19/h1-15,21H,16-17H2,(H,26,30)(H,27,31)/t21-/m0/s1 |
| InChIKey | QHIFZOVOEHPPTM-NRFANRHFSA-N |
| XLogP | 2.88 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|