C24H20N4O2 — CID 34883174
3-methyl-6-phenyl-4-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]-1,2,4-triazin-5-one (PubChem CID 34883174) has the molecular formula C24H20N4O2 and a molecular weight of 396.45 g/mol. Its IUPAC name is 3-methyl-6-phenyl-4-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]-1,2,4-triazin-5-one.
| Compound Name | 3-methyl-6-phenyl-4-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 34883174 |
| Molecular Formula | C24H20N4O2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 3-methyl-6-phenyl-4-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]-1,2,4-triazin-5-one |
| SMILES | Cc1nnc(-c2ccccc2)c(=O)n1/N=C\c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H20N4O2/c1-18-26-27-23(21-10-6-3-7-11-21)24(29)28(18)25-16-19-12-14-22(15-13-19)30-17-20-8-4-2-5-9-20/h2-16H,17H2,1H3/b25-16- |
| InChIKey | OTDDCVYWGWKXSM-XYGWBWBKSA-N |
| XLogP | 4.07 |
| TPSA | 69.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|