C26H38N2O3 — CID 3489229
N-[(3,4-dimethoxyphenyl)methyl]-2-[4-(4-methoxyphenyl)-1,2,5-trimethylpiperidin-4-yl]ethanamine (PubChem CID 3489229) has the molecular formula C26H38N2O3 and a molecular weight of 426.60 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-2-[4-(4-methoxyphenyl)-1,2,5-trimethylpiperidin-4-yl]ethanamine.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-2-[4-(4-methoxyphenyl)-1,2,5-trimethylpiperidin-4-yl]ethanamine |
|---|---|
| PubChem CID | 3489229 |
| Molecular Formula | C26H38N2O3 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-2-[4-(4-methoxyphenyl)-1,2,5-trimethylpiperidin-4-yl]ethanamine |
| SMILES | COc1ccc(C2(CCNCc3ccc(OC)c(OC)c3)CC(C)N(C)CC2C)cc1 |
| InChI | InChI=1S/C26H38N2O3/c1-19-18-28(3)20(2)16-26(19,22-8-10-23(29-4)11-9-22)13-14-27-17-21-7-12-24(30-5)25(15-21)31-6/h7-12,15,19-20,27H,13-14,16-18H2,1-6H3 |
| InChIKey | JPXNLMLEBRFIDG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|