C19H34Cl2N2O3 — CID 90485071
4-[2-[(3,4-dimethoxyphenyl)methylamino]ethyl]-1,2,5-trimethylpiperidin-4-ol;dihydrochloride (PubChem CID 90485071) has the molecular formula C19H34Cl2N2O3 and a molecular weight of 409.40 g/mol. Its IUPAC name is 4-[2-[(3,4-dimethoxyphenyl)methylamino]ethyl]-1,2,5-trimethylpiperidin-4-ol;dihydrochloride.
| Compound Name | 4-[2-[(3,4-dimethoxyphenyl)methylamino]ethyl]-1,2,5-trimethylpiperidin-4-ol;dihydrochloride |
|---|---|
| PubChem CID | 90485071 |
| Molecular Formula | C19H34Cl2N2O3 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 4-[2-[(3,4-dimethoxyphenyl)methylamino]ethyl]-1,2,5-trimethylpiperidin-4-ol;dihydrochloride |
| SMILES | COc1ccc(CNCCC2(O)CC(C)N(C)CC2C)cc1OC.Cl.Cl |
| InChI | InChI=1S/C19H32N2O3.2ClH/c1-14-13-21(3)15(2)11-19(14,22)8-9-20-12-16-6-7-17(23-4)18(10-16)24-5;;/h6-7,10,14-15,20,22H,8-9,11-13H2,1-5H3;2*1H |
| InChIKey | RRSZGSRYNYOSIH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|