C19H34N2O3+2 — CID 7273743
(3,4-dimethoxyphenyl)methyl-[2-[(2R,4S,5R)-4-hydroxy-1,2,5-trimethylpiperidin-1-ium-4-yl]ethyl]azanium (PubChem CID 7273743) has the molecular formula C19H34N2O3+2 and a molecular weight of 338.49 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)methyl-[2-[(2R,4S,5R)-4-hydroxy-1,2,5-trimethylpiperidin-1-ium-4-yl]ethyl]azanium.
| Compound Name | (3,4-dimethoxyphenyl)methyl-[2-[(2R,4S,5R)-4-hydroxy-1,2,5-trimethylpiperidin-1-ium-4-yl]ethyl]azanium |
|---|---|
| PubChem CID | 7273743 |
| Molecular Formula | C19H34N2O3+2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | (3,4-dimethoxyphenyl)methyl-[2-[(2R,4S,5R)-4-hydroxy-1,2,5-trimethylpiperidin-1-ium-4-yl]ethyl]azanium |
| SMILES | COc1ccc(C[NH2+]CC[C@]2(O)C[C@@H](C)[NH+](C)C[C@H]2C)cc1OC |
| InChI | InChI=1S/C19H32N2O3/c1-14-13-21(3)15(2)11-19(14,22)8-9-20-12-16-6-7-17(23-4)18(10-16)24-5/h6-7,10,14-15,20,22H,8-9,11-13H2,1-5H3/p+2/t14-,15-,19+/m1/s1 |
| InChIKey | XHIDEXZXYXIKAG-CLCXKQKWSA-P |
| XLogP | -0.17 |
| TPSA | 59.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|