C26H40N2O2+2 — CID 5140417
2-(4-benzyl-1,2,5-trimethylpiperidin-1-ium-4-yl)ethyl-[(3,4-dimethoxyphenyl)methyl]azanium (PubChem CID 5140417) has the molecular formula C26H40N2O2+2 and a molecular weight of 412.62 g/mol. Its IUPAC name is 2-(4-benzyl-1,2,5-trimethylpiperidin-1-ium-4-yl)ethyl-[(3,4-dimethoxyphenyl)methyl]azanium.
| Compound Name | 2-(4-benzyl-1,2,5-trimethylpiperidin-1-ium-4-yl)ethyl-[(3,4-dimethoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 5140417 |
| Molecular Formula | C26H40N2O2+2 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.31 |
| IUPAC Name | 2-(4-benzyl-1,2,5-trimethylpiperidin-1-ium-4-yl)ethyl-[(3,4-dimethoxyphenyl)methyl]azanium |
| SMILES | COc1ccc(C[NH2+]CCC2(Cc3ccccc3)CC(C)[NH+](C)CC2C)cc1OC |
| InChI | InChI=1S/C26H38N2O2/c1-20-19-28(3)21(2)16-26(20,17-22-9-7-6-8-10-22)13-14-27-18-23-11-12-24(29-4)25(15-23)30-5/h6-12,15,20-21,27H,13-14,16-19H2,1-5H3/p+2 |
| InChIKey | FYBSRGAMRKRJQM-UHFFFAOYSA-P |
| XLogP | 2.33 |
| TPSA | 39.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|