C25H38N2O2+2 — CID 7374770
[(2S,4S,5R)-4-benzyl-1,2,5-trimethylpiperidin-1-ium-4-yl]-[2-(3,4-dimethoxyphenyl)ethyl]azanium (PubChem CID 7374770) has the molecular formula C25H38N2O2+2 and a molecular weight of 398.59 g/mol. Its IUPAC name is [(2S,4S,5R)-4-benzyl-1,2,5-trimethylpiperidin-1-ium-4-yl]-[2-(3,4-dimethoxyphenyl)ethyl]azanium.
| Compound Name | [(2S,4S,5R)-4-benzyl-1,2,5-trimethylpiperidin-1-ium-4-yl]-[2-(3,4-dimethoxyphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 7374770 |
| Molecular Formula | C25H38N2O2+2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | [(2S,4S,5R)-4-benzyl-1,2,5-trimethylpiperidin-1-ium-4-yl]-[2-(3,4-dimethoxyphenyl)ethyl]azanium |
| SMILES | COc1ccc(CC[NH2+][C@@]2(Cc3ccccc3)C[C@H](C)[NH+](C)C[C@H]2C)cc1OC |
| InChI | InChI=1S/C25H36N2O2/c1-19-18-27(3)20(2)16-25(19,17-22-9-7-6-8-10-22)26-14-13-21-11-12-23(28-4)24(15-21)29-5/h6-12,15,19-20,26H,13-14,16-18H2,1-5H3/p+2/t19-,20+,25-/m1/s1 |
| InChIKey | GOTLBDMBTPMJPE-OHUGHZGNSA-P |
| XLogP | 1.73 |
| TPSA | 39.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |