C25H32N2O3 — CID 34897257
4-[[(5-tert-butyl-2,3-dihydroxyphenyl)methyl-cyclopropylamino]methyl]-N-cyclopropylbenzamide (PubChem CID 34897257) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is 4-[[(5-tert-butyl-2,3-dihydroxyphenyl)methyl-cyclopropylamino]methyl]-N-cyclopropylbenzamide.
| Compound Name | 4-[[(5-tert-butyl-2,3-dihydroxyphenyl)methyl-cyclopropylamino]methyl]-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 34897257 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 4-[[(5-tert-butyl-2,3-dihydroxyphenyl)methyl-cyclopropylamino]methyl]-N-cyclopropylbenzamide |
| SMILES | CC(C)(C)c1cc(O)c(O)c(CN(Cc2ccc(C(=O)NC3CC3)cc2)C2CC2)c1 |
| InChI | InChI=1S/C25H32N2O3/c1-25(2,3)19-12-18(23(29)22(28)13-19)15-27(21-10-11-21)14-16-4-6-17(7-5-16)24(30)26-20-8-9-20/h4-7,12-13,20-21,28-29H,8-11,14-15H2,1-3H3,(H,26,30) |
| InChIKey | DFSNNEAPYCGBRO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|