C23H20N2O3S — CID 34907467
N-benzyl-N-(furan-2-ylmethyl)-4-(1,3-thiazol-4-ylmethoxy)benzamide (PubChem CID 34907467) has the molecular formula C23H20N2O3S and a molecular weight of 404.49 g/mol. Its IUPAC name is N-benzyl-N-(furan-2-ylmethyl)-4-(1,3-thiazol-4-ylmethoxy)benzamide.
| Compound Name | N-benzyl-N-(furan-2-ylmethyl)-4-(1,3-thiazol-4-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 34907467 |
| Molecular Formula | C23H20N2O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | N-benzyl-N-(furan-2-ylmethyl)-4-(1,3-thiazol-4-ylmethoxy)benzamide |
| SMILES | O=C(c1ccc(OCc2cscn2)cc1)N(Cc1ccccc1)Cc1ccco1 |
| InChI | InChI=1S/C23H20N2O3S/c26-23(19-8-10-21(11-9-19)28-15-20-16-29-17-24-20)25(14-22-7-4-12-27-22)13-18-5-2-1-3-6-18/h1-12,16-17H,13-15H2 |
| InChIKey | AIJPZLAQXAIPHR-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |