C25H23N3O3 — CID 34907626
N-benzyl-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(furan-2-ylmethyl)-2-oxoacetamide (PubChem CID 34907626) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is N-benzyl-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(furan-2-ylmethyl)-2-oxoacetamide.
| Compound Name | N-benzyl-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(furan-2-ylmethyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 34907626 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | N-benzyl-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(furan-2-ylmethyl)-2-oxoacetamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)C(=O)N(Cc1ccccc1)Cc1ccco1 |
| InChI | InChI=1S/C25H23N3O3/c1-18-23(19(2)28(26-18)21-12-7-4-8-13-21)24(29)25(30)27(17-22-14-9-15-31-22)16-20-10-5-3-6-11-20/h3-15H,16-17H2,1-2H3 |
| InChIKey | GQYLAOKTXYIEPB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|