C13H18N4O3 — CID 34910056
3-[benzyl-[2-(carbamoylamino)-2-oxoethyl]amino]propanamide (PubChem CID 34910056) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is 3-[benzyl-[2-(carbamoylamino)-2-oxoethyl]amino]propanamide.
| Compound Name | 3-[benzyl-[2-(carbamoylamino)-2-oxoethyl]amino]propanamide |
|---|---|
| PubChem CID | 34910056 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 3-[benzyl-[2-(carbamoylamino)-2-oxoethyl]amino]propanamide |
| SMILES | NC(=O)CCN(CC(=O)NC(N)=O)Cc1ccccc1 |
| InChI | InChI=1S/C13H18N4O3/c14-11(18)6-7-17(9-12(19)16-13(15)20)8-10-4-2-1-3-5-10/h1-5H,6-9H2,(H2,14,18)(H3,15,16,19,20) |
| InChIKey | GFIFZTLHMSHUFX-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |