C15H13BrN4O — CID 3491293
2-[(4-bromophenyl)-(1,2,4-triazol-4-ylamino)methyl]phenol (PubChem CID 3491293) has the molecular formula C15H13BrN4O and a molecular weight of 345.20 g/mol. Its IUPAC name is 2-[(4-bromophenyl)-(1,2,4-triazol-4-ylamino)methyl]phenol.
| Compound Name | 2-[(4-bromophenyl)-(1,2,4-triazol-4-ylamino)methyl]phenol |
|---|---|
| PubChem CID | 3491293 |
| Molecular Formula | C15H13BrN4O |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 2-[(4-bromophenyl)-(1,2,4-triazol-4-ylamino)methyl]phenol |
| SMILES | Oc1ccccc1C(Nn1cnnc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H13BrN4O/c16-12-7-5-11(6-8-12)15(19-20-9-17-18-10-20)13-3-1-2-4-14(13)21/h1-10,15,19,21H |
| InChIKey | KCNBZPANJAGBSX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|