C24H18BrN3O3 — CID 108791406
N-benzhydryl-1-(4-bromophenyl)-4-hydroxy-6-oxopyridazine-3-carboxamide (PubChem CID 108791406) has the molecular formula C24H18BrN3O3 and a molecular weight of 476.33 g/mol. Its IUPAC name is N-benzhydryl-1-(4-bromophenyl)-4-hydroxy-6-oxopyridazine-3-carboxamide.
| Compound Name | N-benzhydryl-1-(4-bromophenyl)-4-hydroxy-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 108791406 |
| Molecular Formula | C24H18BrN3O3 |
| Molecular Weight | 476.33 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | N-benzhydryl-1-(4-bromophenyl)-4-hydroxy-6-oxopyridazine-3-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1ccccc1)c1nn(-c2ccc(Br)cc2)c(=O)cc1O |
| InChI | InChI=1S/C24H18BrN3O3/c25-18-11-13-19(14-12-18)28-21(30)15-20(29)23(27-28)24(31)26-22(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-15,22,29H,(H,26,31) |
| InChIKey | AIAQGFLBXATYNG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.33 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |