C18H11BrClN3O5 — CID 108803869
5-[[1-(4-bromophenyl)-4-hydroxy-6-oxopyridazine-3-carbonyl]amino]-2-chlorobenzoic acid (PubChem CID 108803869) has the molecular formula C18H11BrClN3O5 and a molecular weight of 464.66 g/mol. Its IUPAC name is 5-[[1-(4-bromophenyl)-4-hydroxy-6-oxopyridazine-3-carbonyl]amino]-2-chlorobenzoic acid.
| Compound Name | 5-[[1-(4-bromophenyl)-4-hydroxy-6-oxopyridazine-3-carbonyl]amino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 108803869 |
| Molecular Formula | C18H11BrClN3O5 |
| Molecular Weight | 464.66 g/mol |
| Exact Mass | 462.96 |
| IUPAC Name | 5-[[1-(4-bromophenyl)-4-hydroxy-6-oxopyridazine-3-carbonyl]amino]-2-chlorobenzoic acid |
| SMILES | O=C(O)c1cc(NC(=O)c2nn(-c3ccc(Br)cc3)c(=O)cc2O)ccc1Cl |
| InChI | InChI=1S/C18H11BrClN3O5/c19-9-1-4-11(5-2-9)23-15(25)8-14(24)16(22-23)17(26)21-10-3-6-13(20)12(7-10)18(27)28/h1-8,24H,(H,21,26)(H,27,28) |
| InChIKey | AHXNFPMJMRTVOW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.66 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |