C20H17N5O7S — CID 3492477
methyl 3-[[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]carbamoyl]-5-nitrobenzoate (PubChem CID 3492477) has the molecular formula C20H17N5O7S and a molecular weight of 471.45 g/mol. Its IUPAC name is methyl 3-[[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]carbamoyl]-5-nitrobenzoate.
| Compound Name | methyl 3-[[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]carbamoyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 3492477 |
| Molecular Formula | C20H17N5O7S |
| Molecular Weight | 471.45 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | methyl 3-[[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]carbamoyl]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc(C(=O)Nc2ccc(S(=O)(=O)Nc3nccc(C)n3)cc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H17N5O7S/c1-12-7-8-21-20(22-12)24-33(30,31)17-5-3-15(4-6-17)23-18(26)13-9-14(19(27)32-2)11-16(10-13)25(28)29/h3-11H,1-2H3,(H,23,26)(H,21,22,24) |
| InChIKey | FLGVZJUWXMRGRN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 170.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|