C17H13F2N3O2 — CID 3494554
2-(3-aminophenyl)-N-[(3,4-difluorophenyl)methyl]-1,3-oxazole-4-carboxamide (PubChem CID 3494554) has the molecular formula C17H13F2N3O2 and a molecular weight of 329.31 g/mol. Its IUPAC name is 2-(3-aminophenyl)-N-[(3,4-difluorophenyl)methyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(3-aminophenyl)-N-[(3,4-difluorophenyl)methyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3494554 |
| Molecular Formula | C17H13F2N3O2 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 2-(3-aminophenyl)-N-[(3,4-difluorophenyl)methyl]-1,3-oxazole-4-carboxamide |
| SMILES | Nc1cccc(-c2nc(C(=O)NCc3ccc(F)c(F)c3)co2)c1 |
| InChI | InChI=1S/C17H13F2N3O2/c18-13-5-4-10(6-14(13)19)8-21-16(23)15-9-24-17(22-15)11-2-1-3-12(20)7-11/h1-7,9H,8,20H2,(H,21,23) |
| InChIKey | FCPISLOKYHERNG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|