C22H27NO5S — CID 34949610
1-[(2R)-2-[2-(benzenesulfonyl)ethyl]piperidin-1-yl]-2-(4-methoxyphenoxy)ethanone (PubChem CID 34949610) has the molecular formula C22H27NO5S and a molecular weight of 417.53 g/mol. Its IUPAC name is 1-[(2R)-2-[2-(benzenesulfonyl)ethyl]piperidin-1-yl]-2-(4-methoxyphenoxy)ethanone.
| Compound Name | 1-[(2R)-2-[2-(benzenesulfonyl)ethyl]piperidin-1-yl]-2-(4-methoxyphenoxy)ethanone |
|---|---|
| PubChem CID | 34949610 |
| Molecular Formula | C22H27NO5S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 1-[(2R)-2-[2-(benzenesulfonyl)ethyl]piperidin-1-yl]-2-(4-methoxyphenoxy)ethanone |
| SMILES | COc1ccc(OCC(=O)N2CCCC[C@@H]2CCS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H27NO5S/c1-27-19-10-12-20(13-11-19)28-17-22(24)23-15-6-5-7-18(23)14-16-29(25,26)21-8-3-2-4-9-21/h2-4,8-13,18H,5-7,14-17H2,1H3/t18-/m1/s1 |
| InChIKey | OHQLCYBHXYBKBS-GOSISDBHSA-N |
| XLogP | 3.32 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |