C19H10Cl2N4S — CID 3495930
3-(3,4-dichlorophenyl)-2-thiophen-2-ylimidazo[4,5-b]quinoxaline (PubChem CID 3495930) has the molecular formula C19H10Cl2N4S and a molecular weight of 397.29 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-2-thiophen-2-ylimidazo[4,5-b]quinoxaline.
| Compound Name | 3-(3,4-dichlorophenyl)-2-thiophen-2-ylimidazo[4,5-b]quinoxaline |
|---|---|
| PubChem CID | 3495930 |
| Molecular Formula | C19H10Cl2N4S |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 396.00 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-2-thiophen-2-ylimidazo[4,5-b]quinoxaline |
| SMILES | Clc1ccc(-n2c(-c3cccs3)nc3nc4ccccc4nc32)cc1Cl |
| InChI | InChI=1S/C19H10Cl2N4S/c20-12-8-7-11(10-13(12)21)25-18(16-6-3-9-26-16)24-17-19(25)23-15-5-2-1-4-14(15)22-17/h1-10H |
| InChIKey | DTXNLYFDIJATNP-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |