C17H16N4S — CID 943558
3-[(2S)-butan-2-yl]-2-thiophen-2-ylimidazo[4,5-b]quinoxaline (PubChem CID 943558) has the molecular formula C17H16N4S and a molecular weight of 308.41 g/mol. Its IUPAC name is 3-[(2S)-butan-2-yl]-2-thiophen-2-ylimidazo[4,5-b]quinoxaline.
| Compound Name | 3-[(2S)-butan-2-yl]-2-thiophen-2-ylimidazo[4,5-b]quinoxaline |
|---|---|
| PubChem CID | 943558 |
| Molecular Formula | C17H16N4S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 3-[(2S)-butan-2-yl]-2-thiophen-2-ylimidazo[4,5-b]quinoxaline |
| SMILES | CC[C@H](C)n1c(-c2cccs2)nc2nc3ccccc3nc21 |
| InChI | InChI=1S/C17H16N4S/c1-3-11(2)21-16(14-9-6-10-22-14)20-15-17(21)19-13-8-5-4-7-12(13)18-15/h4-11H,3H2,1-2H3/t11-/m0/s1 |
| InChIKey | MVIZQVBDUVVXQS-NSHDSACASA-N |
| XLogP | 4.68 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |