C11H7N3S — CID 135025345
3-thiophen-2-yl-1,2,4-benzotriazine (PubChem CID 135025345) has the molecular formula C11H7N3S and a molecular weight of 213.27 g/mol. Its IUPAC name is 3-thiophen-2-yl-1,2,4-benzotriazine.
| Compound Name | 3-thiophen-2-yl-1,2,4-benzotriazine |
|---|---|
| PubChem CID | 135025345 |
| Molecular Formula | C11H7N3S |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 3-thiophen-2-yl-1,2,4-benzotriazine |
| SMILES | c1csc(-c2nnc3ccccc3n2)c1 |
| InChI | InChI=1S/C11H7N3S/c1-2-5-9-8(4-1)12-11(14-13-9)10-6-3-7-15-10/h1-7H |
| InChIKey | FSLUCZANMBLYGX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |