C23H16N4S2 — CID 139202565
N,N-diphenyl-4,6-dithiophen-2-yl-1,3,5-triazin-2-amine (PubChem CID 139202565) has the molecular formula C23H16N4S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is N,N-diphenyl-4,6-dithiophen-2-yl-1,3,5-triazin-2-amine.
| Compound Name | N,N-diphenyl-4,6-dithiophen-2-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 139202565 |
| Molecular Formula | C23H16N4S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | N,N-diphenyl-4,6-dithiophen-2-yl-1,3,5-triazin-2-amine |
| SMILES | c1ccc(N(c2ccccc2)c2nc(-c3cccs3)nc(-c3cccs3)n2)cc1 |
| InChI | InChI=1S/C23H16N4S2/c1-3-9-17(10-4-1)27(18-11-5-2-6-12-18)23-25-21(19-13-7-15-28-19)24-22(26-23)20-14-8-16-29-20/h1-16H |
| InChIKey | JHLPTAQIGPUPEO-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |