C11H11N3O2S — CID 82169824
6-(ethylamino)-2-thiophen-2-ylpyrimidine-4-carboxylic acid (PubChem CID 82169824) has the molecular formula C11H11N3O2S and a molecular weight of 249.30 g/mol. Its IUPAC name is 6-(ethylamino)-2-thiophen-2-ylpyrimidine-4-carboxylic acid.
| Compound Name | 6-(ethylamino)-2-thiophen-2-ylpyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 82169824 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 6-(ethylamino)-2-thiophen-2-ylpyrimidine-4-carboxylic acid |
| SMILES | CCNc1cc(C(=O)O)nc(-c2cccs2)n1 |
| InChI | InChI=1S/C11H11N3O2S/c1-2-12-9-6-7(11(15)16)13-10(14-9)8-4-3-5-17-8/h3-6H,2H2,1H3,(H,15,16)(H,12,13,14) |
| InChIKey | SVZDJNSZHKWHKN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |