C20H17N3S2 — CID 126550812
2-(4-propan-2-ylphenyl)-4,6-dithiophen-2-yl-1,3,5-triazine (PubChem CID 126550812) has the molecular formula C20H17N3S2 and a molecular weight of 363.51 g/mol. Its IUPAC name is 2-(4-propan-2-ylphenyl)-4,6-dithiophen-2-yl-1,3,5-triazine.
| Compound Name | 2-(4-propan-2-ylphenyl)-4,6-dithiophen-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 126550812 |
| Molecular Formula | C20H17N3S2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-(4-propan-2-ylphenyl)-4,6-dithiophen-2-yl-1,3,5-triazine |
| SMILES | CC(C)c1ccc(-c2nc(-c3cccs3)nc(-c3cccs3)n2)cc1 |
| InChI | InChI=1S/C20H17N3S2/c1-13(2)14-7-9-15(10-8-14)18-21-19(16-5-3-11-24-16)23-20(22-18)17-6-4-12-25-17/h3-13H,1-2H3 |
| InChIKey | JBMCKMHLRBIKLT-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |