C47H26N6S4 — CID 58233283
2-[7'-(4,6-dithiophen-2-yl-1,3,5-triazin-2-yl)-9,9'-spirobi[fluorene]-2'-yl]-4,6-dithiophen-2-yl-1,3,5-triazine (PubChem CID 58233283) has the molecular formula C47H26N6S4 and a molecular weight of 803.04 g/mol. Its IUPAC name is 2-[7'-(4,6-dithiophen-2-yl-1,3,5-triazin-2-yl)-9,9'-spirobi[fluorene]-2'-yl]-4,6-dithiophen-2-yl-1,3,5-triazine.
| Compound Name | 2-[7'-(4,6-dithiophen-2-yl-1,3,5-triazin-2-yl)-9,9'-spirobi[fluorene]-2'-yl]-4,6-dithiophen-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 58233283 |
| Molecular Formula | C47H26N6S4 |
| Molecular Weight | 803.04 g/mol |
| Exact Mass | 802.11 |
| IUPAC Name | 2-[7'-(4,6-dithiophen-2-yl-1,3,5-triazin-2-yl)-9,9'-spirobi[fluorene]-2'-yl]-4,6-dithiophen-2-yl-1,3,5-triazine |
| SMILES | c1csc(-c2nc(-c3ccc4c(c3)C3(c5ccccc5-c5ccccc53)c3cc(-c5nc(-c6cccs6)nc(-c6cccs6)n5)ccc3-4)nc(-c3cccs3)n2)c1 |
| InChI | InChI=1S/C47H26N6S4/c1-3-11-33-29(9-1)30-10-2-4-12-34(30)47(33)35-25-27(41-48-43(37-13-5-21-54-37)52-44(49-41)38-14-6-22-55-38)17-19-31(35)32-20-18-28(26-36(32)47)42-50-45(39-15-7-23-56-39)53-46(51-42)40-16-8-24-57-40/h1-26H |
| InChIKey | PMMZVKPEOYDDTA-UHFFFAOYSA-N |
| XLogP | 12.65 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.04 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |