C10H7N3S — CID 11830469
2-thiophen-2-yl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 11830469) has the molecular formula C10H7N3S and a molecular weight of 201.25 g/mol. Its IUPAC name is 2-thiophen-2-yl-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-thiophen-2-yl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 11830469 |
| Molecular Formula | C10H7N3S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 2-thiophen-2-yl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | c1csc(-c2nc3ccccn3n2)c1 |
| InChI | InChI=1S/C10H7N3S/c1-2-6-13-9(5-1)11-10(12-13)8-4-3-7-14-8/h1-7H |
| InChIKey | MNYNAMZGJDXJLL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |