C11H8N2S — CID 154553169
3-thiophen-2-ylimidazo[1,2-a]pyridine (PubChem CID 154553169) has the molecular formula C11H8N2S and a molecular weight of 200.27 g/mol. Its IUPAC name is 3-thiophen-2-ylimidazo[1,2-a]pyridine.
| Compound Name | 3-thiophen-2-ylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 154553169 |
| Molecular Formula | C11H8N2S |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 3-thiophen-2-ylimidazo[1,2-a]pyridine |
| SMILES | c1csc(-c2cnc3ccccn23)c1 |
| InChI | InChI=1S/C11H8N2S/c1-2-6-13-9(8-12-11(13)5-1)10-4-3-7-14-10/h1-8H |
| InChIKey | QPFDNQUHLCUUEZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |