C18H15N3S — CID 808655
N-benzyl-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-amine (PubChem CID 808655) has the molecular formula C18H15N3S and a molecular weight of 305.41 g/mol. Its IUPAC name is N-benzyl-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-amine.
| Compound Name | N-benzyl-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 808655 |
| Molecular Formula | C18H15N3S |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N-benzyl-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-amine |
| SMILES | c1ccc(CNc2c(-c3cccs3)nc3ccccn23)cc1 |
| InChI | InChI=1S/C18H15N3S/c1-2-7-14(8-3-1)13-19-18-17(15-9-6-12-22-15)20-16-10-4-5-11-21(16)18/h1-12,19H,13H2 |
| InChIKey | NJAVVNOILNLFJD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |