C16H23NO4S — CID 35025063
(2,2-dimethylmorpholin-4-yl)-(2-propylsulfonylphenyl)methanone (PubChem CID 35025063) has the molecular formula C16H23NO4S and a molecular weight of 325.43 g/mol. Its IUPAC name is (2,2-dimethylmorpholin-4-yl)-(2-propylsulfonylphenyl)methanone.
| Compound Name | (2,2-dimethylmorpholin-4-yl)-(2-propylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 35025063 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (2,2-dimethylmorpholin-4-yl)-(2-propylsulfonylphenyl)methanone |
| SMILES | CCCS(=O)(=O)c1ccccc1C(=O)N1CCOC(C)(C)C1 |
| InChI | InChI=1S/C16H23NO4S/c1-4-11-22(19,20)14-8-6-5-7-13(14)15(18)17-9-10-21-16(2,3)12-17/h5-8H,4,9-12H2,1-3H3 |
| InChIKey | WERVQPHFMAFUQI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |