C14H12F2N2O3S — CID 35036117
4-(difluoromethylsulfonyl)-N-(6-methyl-2-pyridinyl)benzamide (PubChem CID 35036117) has the molecular formula C14H12F2N2O3S and a molecular weight of 326.32 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-(6-methyl-2-pyridinyl)benzamide.
| Compound Name | 4-(difluoromethylsulfonyl)-N-(6-methyl-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 35036117 |
| Molecular Formula | C14H12F2N2O3S |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-(6-methyl-2-pyridinyl)benzamide |
| SMILES | Cc1cccc(NC(=O)c2ccc(S(=O)(=O)C(F)F)cc2)n1 |
| InChI | InChI=1S/C14H12F2N2O3S/c1-9-3-2-4-12(17-9)18-13(19)10-5-7-11(8-6-10)22(20,21)14(15)16/h2-8,14H,1H3,(H,17,18,19) |
| InChIKey | LPMLXXJHUXZIGO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |