C19H23IN4O3S2 — CID 3503666
ethyl 6-ethyl-2-[(4-iodo-1-methylpyrazole-5-carbonyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 3503666) has the molecular formula C19H23IN4O3S2 and a molecular weight of 546.46 g/mol. Its IUPAC name is ethyl 6-ethyl-2-[(4-iodo-1-methylpyrazole-5-carbonyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 6-ethyl-2-[(4-iodo-1-methylpyrazole-5-carbonyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3503666 |
| Molecular Formula | C19H23IN4O3S2 |
| Molecular Weight | 546.46 g/mol |
| Exact Mass | 546.03 |
| IUPAC Name | ethyl 6-ethyl-2-[(4-iodo-1-methylpyrazole-5-carbonyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)NC(=O)c2c(I)cnn2C)sc2c1CCC(CC)C2 |
| InChI | InChI=1S/C19H23IN4O3S2/c1-4-10-6-7-11-13(8-10)29-17(14(11)18(26)27-5-2)23-19(28)22-16(25)15-12(20)9-21-24(15)3/h9-10H,4-8H2,1-3H3,(H2,22,23,25,28) |
| InChIKey | PFWPUTMDCSMGLO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|